C11H24N2O5S — CID 156729822
2-hydroxy-3-[4-(2-hydroxybutyl)piperazin-1-yl]propane-1-sulfonic acid (PubChem CID 156729822) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-hydroxy-3-[4-(2-hydroxybutyl)piperazin-1-yl]propane-1-sulfonic acid.
| Compound Name | 2-hydroxy-3-[4-(2-hydroxybutyl)piperazin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 156729822 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-hydroxy-3-[4-(2-hydroxybutyl)piperazin-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(O)CN1CCN(CC(O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C11H24N2O5S/c1-2-10(14)7-12-3-5-13(6-4-12)8-11(15)9-19(16,17)18/h10-11,14-15H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | GKQQLJCKWSPAOO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|