C7H16N2O4S — CID 126476628
(2R)-2-hydroxy-3-piperazin-1-ylpropane-1-sulfonic acid (PubChem CID 126476628) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-piperazin-1-ylpropane-1-sulfonic acid.
| Compound Name | (2R)-2-hydroxy-3-piperazin-1-ylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 126476628 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2R)-2-hydroxy-3-piperazin-1-ylpropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C[C@H](O)CN1CCNCC1 |
| InChI | InChI=1S/C7H16N2O4S/c10-7(6-14(11,12)13)5-9-3-1-8-2-4-9/h7-8,10H,1-6H2,(H,11,12,13)/t7-/m1/s1 |
| InChIKey | GSIJELIJPWMEGH-SSDOTTSWSA-N |
| XLogP | -1.86 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|