C8H18N2O4S — CID 87724398
3-hydroxy-1-piperazin-1-ylbutane-2-sulfonic acid (PubChem CID 87724398) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-hydroxy-1-piperazin-1-ylbutane-2-sulfonic acid.
| Compound Name | 3-hydroxy-1-piperazin-1-ylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 87724398 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-hydroxy-1-piperazin-1-ylbutane-2-sulfonic acid |
| SMILES | CC(O)C(CN1CCNCC1)S(=O)(=O)O |
| InChI | InChI=1S/C8H18N2O4S/c1-7(11)8(15(12,13)14)6-10-4-2-9-3-5-10/h7-9,11H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | JRHOHTKGOMWJEL-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|