C10H20N4O6S — CID 2051357
(2S)-3-[4-(3-hydrazinyl-3-oxopropanoyl)piperazin-1-yl]-2-hydroxypropane-1-sulfonic acid (PubChem CID 2051357) has the molecular formula C10H20N4O6S and a molecular weight of 324.36 g/mol. Its IUPAC name is (2S)-3-[4-(3-hydrazinyl-3-oxopropanoyl)piperazin-1-yl]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | (2S)-3-[4-(3-hydrazinyl-3-oxopropanoyl)piperazin-1-yl]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 2051357 |
| Molecular Formula | C10H20N4O6S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2S)-3-[4-(3-hydrazinyl-3-oxopropanoyl)piperazin-1-yl]-2-hydroxypropane-1-sulfonic acid |
| SMILES | NNC(=O)CC(=O)N1CCN(C[C@H](O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C10H20N4O6S/c11-12-9(16)5-10(17)14-3-1-13(2-4-14)6-8(15)7-21(18,19)20/h8,15H,1-7,11H2,(H,12,16)(H,18,19,20)/t8-/m0/s1 |
| InChIKey | YEUCOFMLTGLJER-QMMMGPOBSA-N |
| XLogP | -3.24 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|