C15H22N2O7S — CID 2051367
(2R)-2-hydroxy-3-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-yl]propane-1-sulfonic acid (PubChem CID 2051367) has the molecular formula C15H22N2O7S and a molecular weight of 374.42 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-yl]propane-1-sulfonic acid.
| Compound Name | (2R)-2-hydroxy-3-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 2051367 |
| Molecular Formula | C15H22N2O7S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2R)-2-hydroxy-3-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-yl]propane-1-sulfonic acid |
| SMILES | O=C(COc1cccc(O)c1)N1CCN(C[C@@H](O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H22N2O7S/c18-12-2-1-3-14(8-12)24-10-15(20)17-6-4-16(5-7-17)9-13(19)11-25(21,22)23/h1-3,8,13,18-19H,4-7,9-11H2,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | SAWVJBFXCKNEGK-CYBMUJFWSA-N |
| XLogP | -0.84 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|