C14H20N2O6S — CID 2051318
2-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-ium-1-yl]ethanesulfonate (PubChem CID 2051318) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | 2-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 2051318 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[4-[2-(3-hydroxyphenoxy)acetyl]piperazin-1-ium-1-yl]ethanesulfonate |
| SMILES | O=C(COc1cccc(O)c1)N1CC[NH+](CCS(=O)(=O)[O-])CC1 |
| InChI | InChI=1S/C14H20N2O6S/c17-12-2-1-3-13(10-12)22-11-14(18)16-6-4-15(5-7-16)8-9-23(19,20)21/h1-3,10,17H,4-9,11H2,(H,19,20,21) |
| InChIKey | FVDSCPMCCREYMA-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|