C16H19N2O6- — CID 2050396
3-[4-[2-(3-methoxyphenoxy)acetyl]piperazin-1-yl]-3-oxopropanoate (PubChem CID 2050396) has the molecular formula C16H19N2O6- and a molecular weight of 335.34 g/mol. Its IUPAC name is 3-[4-[2-(3-methoxyphenoxy)acetyl]piperazin-1-yl]-3-oxopropanoate.
| Compound Name | 3-[4-[2-(3-methoxyphenoxy)acetyl]piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 2050396 |
| Molecular Formula | C16H19N2O6- |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-[4-[2-(3-methoxyphenoxy)acetyl]piperazin-1-yl]-3-oxopropanoate |
| SMILES | COc1cccc(OCC(=O)N2CCN(C(=O)CC(=O)[O-])CC2)c1 |
| InChI | InChI=1S/C16H20N2O6/c1-23-12-3-2-4-13(9-12)24-11-15(20)18-7-5-17(6-8-18)14(19)10-16(21)22/h2-4,9H,5-8,10-11H2,1H3,(H,21,22)/p-1 |
| InChIKey | IITPXHNOLSHQJW-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|