C57H120N7O24S6Si+ — CID 167409091
trioctyl-[3-tris[[1-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]-3-sulfopropan-2-yl]oxy]silylpropyl]azanium (PubChem CID 167409091) has the molecular formula C57H120N7O24S6Si+ and a molecular weight of 1508.10 g/mol. Its IUPAC name is trioctyl-[3-tris[[1-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]-3-sulfopropan-2-yl]oxy]silylpropyl]azanium.
| Compound Name | trioctyl-[3-tris[[1-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]-3-sulfopropan-2-yl]oxy]silylpropyl]azanium |
|---|---|
| PubChem CID | 167409091 |
| Molecular Formula | C57H120N7O24S6Si+ |
| Molecular Weight | 1508.10 g/mol |
| Exact Mass | 1506.65 |
| IUPAC Name | trioctyl-[3-tris[[1-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]-3-sulfopropan-2-yl]oxy]silylpropyl]azanium |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCC[Si](OC(CN1CCN(CC(O)CS(=O)(=O)O)CC1)CS(=O)(=O)O)(OC(CN1CCN(CC(O)CS(=O)(=O)O)CC1)CS(=O)(=O)O)OC(CN1CCN(CC(O)CS(=O)(=O)O)CC1)CS(=O)(=O)O |
| InChI | InChI=1S/C57H119N7O24S6Si/c1-4-7-10-13-16-19-35-64(36-20-17-14-11-8-5-2,37-21-18-15-12-9-6-3)38-22-39-95(86-55(49-92(77,78)79)43-61-29-23-58(24-30-61)40-52(65)46-89(68,69)70,87-56(50-93(80,81)82)44-62-31-25-59(26-32-62)41-53(66)47-90(71,72)73)88-57(51-94(83,84)85)45-63-33-27-60(28-34-63)42-54(67)48-91(74,75)76/h52-57,65-67H,4-51H2,1-3H3,(H5-,68,69,70,71,72,73,74,75,76,77,78,79,80,81,82,83,84,85)/p+1 |
| InChIKey | UTVFALRMWFYUIW-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 434.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1508.10 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|