C13H17N3O4S — CID 107272008
1-(2,4-dinitrophenyl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine (PubChem CID 107272008) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine.
| Compound Name | 1-(2,4-dinitrophenyl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine |
|---|---|
| PubChem CID | 107272008 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine |
| SMILES | CSC1(CNCc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCC1 |
| InChI | InChI=1S/C13H17N3O4S/c1-21-13(5-2-6-13)9-14-8-10-3-4-11(15(17)18)7-12(10)16(19)20/h3-4,7,14H,2,5-6,8-9H2,1H3 |
| InChIKey | YVCBOKZVRAWHRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|