C16H16BrFN2O — CID 107272903
3-(2-aminophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]propanamide (PubChem CID 107272903) has the molecular formula C16H16BrFN2O and a molecular weight of 351.22 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 107272903 |
| Molecular Formula | C16H16BrFN2O |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-(2-aminophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]propanamide |
| SMILES | Nc1ccccc1CCC(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C16H16BrFN2O/c17-14-7-6-13(18)9-12(14)10-20-16(21)8-5-11-3-1-2-4-15(11)19/h1-4,6-7,9H,5,8,10,19H2,(H,20,21) |
| InChIKey | ZRKXQKFILAYNDH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|