C11H13BrFN3O2 — CID 54902515
2-amino-N-[2-[(2-bromo-5-fluorophenyl)methylamino]-2-oxoethyl]acetamide (PubChem CID 54902515) has the molecular formula C11H13BrFN3O2 and a molecular weight of 318.15 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-bromo-5-fluorophenyl)methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[(2-bromo-5-fluorophenyl)methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 54902515 |
| Molecular Formula | C11H13BrFN3O2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-amino-N-[2-[(2-bromo-5-fluorophenyl)methylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H13BrFN3O2/c12-9-2-1-8(13)3-7(9)5-15-11(18)6-16-10(17)4-14/h1-3H,4-6,14H2,(H,15,18)(H,16,17) |
| InChIKey | LSPZEMDICUIGAR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |