C11H10O5 — CID 10727725
4-(hydroxymethyl)-5-(4-methoxyphenyl)-1,3-dioxol-2-one (PubChem CID 10727725) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-(hydroxymethyl)-5-(4-methoxyphenyl)-1,3-dioxol-2-one.
| Compound Name | 4-(hydroxymethyl)-5-(4-methoxyphenyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 10727725 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-(hydroxymethyl)-5-(4-methoxyphenyl)-1,3-dioxol-2-one |
| SMILES | COc1ccc(-c2oc(=O)oc2CO)cc1 |
| InChI | InChI=1S/C11H10O5/c1-14-8-4-2-7(3-5-8)10-9(6-12)15-11(13)16-10/h2-5,12H,6H2,1H3 |
| InChIKey | ARAFGNBTYXWJFF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |