C12H11F3O — CID 10728032
(3-ethoxy-4,4,4-trifluorobuta-1,2-dienyl)benzene (PubChem CID 10728032) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is (3-ethoxy-4,4,4-trifluorobuta-1,2-dienyl)benzene.
| Compound Name | (3-ethoxy-4,4,4-trifluorobuta-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 10728032 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (3-ethoxy-4,4,4-trifluorobuta-1,2-dienyl)benzene |
| SMILES | CCOC(=C=Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O/c1-2-16-11(12(13,14)15)9-8-10-6-4-3-5-7-10/h3-8H,2H2,1H3 |
| InChIKey | GARYIVHINHDJQR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|