C15H17BrN2O2 — CID 107281357
methyl 2-[1-(3-bromo-4-cyanophenyl)piperidin-2-yl]acetate (PubChem CID 107281357) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is methyl 2-[1-(3-bromo-4-cyanophenyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(3-bromo-4-cyanophenyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 107281357 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | methyl 2-[1-(3-bromo-4-cyanophenyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1c1ccc(C#N)c(Br)c1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-20-15(19)9-12-4-2-3-7-18(12)13-6-5-11(10-17)14(16)8-13/h5-6,8,12H,2-4,7,9H2,1H3 |
| InChIKey | SBAWEJOVEPSIPK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |