C14H18BrN3O — CID 107280896
4-[2-(aminomethyl)-4-methoxypiperidin-1-yl]-2-bromobenzonitrile (PubChem CID 107280896) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-4-methoxypiperidin-1-yl]-2-bromobenzonitrile.
| Compound Name | 4-[2-(aminomethyl)-4-methoxypiperidin-1-yl]-2-bromobenzonitrile |
|---|---|
| PubChem CID | 107280896 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-[2-(aminomethyl)-4-methoxypiperidin-1-yl]-2-bromobenzonitrile |
| SMILES | COC1CCN(c2ccc(C#N)c(Br)c2)C(CN)C1 |
| InChI | InChI=1S/C14H18BrN3O/c1-19-13-4-5-18(12(6-13)9-17)11-3-2-10(8-16)14(15)7-11/h2-3,7,12-13H,4-6,9,17H2,1H3 |
| InChIKey | IQNHOCBAXFCSRA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |