C13H18BrN3O3 — CID 115963898
[1-(2-bromo-4-nitrophenyl)-4-methoxypiperidin-2-yl]methanamine (PubChem CID 115963898) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is [1-(2-bromo-4-nitrophenyl)-4-methoxypiperidin-2-yl]methanamine.
| Compound Name | [1-(2-bromo-4-nitrophenyl)-4-methoxypiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115963898 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [1-(2-bromo-4-nitrophenyl)-4-methoxypiperidin-2-yl]methanamine |
| SMILES | COC1CCN(c2ccc([N+](=O)[O-])cc2Br)C(CN)C1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-20-11-4-5-16(10(6-11)8-15)13-3-2-9(17(18)19)7-12(13)14/h2-3,7,10-11H,4-6,8,15H2,1H3 |
| InChIKey | PLRYUBNFYCDZAD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|