C12H20N4O2 — CID 112622803
[4-methoxy-1-(6-methoxypyrimidin-4-yl)piperidin-2-yl]methanamine (PubChem CID 112622803) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is [4-methoxy-1-(6-methoxypyrimidin-4-yl)piperidin-2-yl]methanamine.
| Compound Name | [4-methoxy-1-(6-methoxypyrimidin-4-yl)piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 112622803 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [4-methoxy-1-(6-methoxypyrimidin-4-yl)piperidin-2-yl]methanamine |
| SMILES | COc1cc(N2CCC(OC)CC2CN)ncn1 |
| InChI | InChI=1S/C12H20N4O2/c1-17-10-3-4-16(9(5-10)7-13)11-6-12(18-2)15-8-14-11/h6,8-10H,3-5,7,13H2,1-2H3 |
| InChIKey | LRDCNSMLUYOGPX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |