C10H16N4O2 — CID 83095664
[4-(6-methoxypyrimidin-4-yl)morpholin-3-yl]methanamine (PubChem CID 83095664) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is [4-(6-methoxypyrimidin-4-yl)morpholin-3-yl]methanamine.
| Compound Name | [4-(6-methoxypyrimidin-4-yl)morpholin-3-yl]methanamine |
|---|---|
| PubChem CID | 83095664 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | [4-(6-methoxypyrimidin-4-yl)morpholin-3-yl]methanamine |
| SMILES | COc1cc(N2CCOCC2CN)ncn1 |
| InChI | InChI=1S/C10H16N4O2/c1-15-10-4-9(12-7-13-10)14-2-3-16-6-8(14)5-11/h4,7-8H,2-3,5-6,11H2,1H3 |
| InChIKey | VDLZZXJYWKFRSB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |