C10H17ClN2O2 — CID 10728317
1-(2-chloroacetyl)-3,3-dimethylpiperidine-2-carboxamide (PubChem CID 10728317) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-3,3-dimethylpiperidine-2-carboxamide.
| Compound Name | 1-(2-chloroacetyl)-3,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 10728317 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-(2-chloroacetyl)-3,3-dimethylpiperidine-2-carboxamide |
| SMILES | CC1(C)CCCN(C(=O)CCl)C1C(N)=O |
| InChI | InChI=1S/C10H17ClN2O2/c1-10(2)4-3-5-13(7(14)6-11)8(10)9(12)15/h8H,3-6H2,1-2H3,(H2,12,15) |
| InChIKey | UYHSUJADVRBJJD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|