(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid

C13H19NO3 — CID 10728575

IUPAC(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid
SMILESC[C@H](OCc1ccccc1)[C@@H](C(=O)O)[C@@H](C)N
InChIInChI=1S/C13H19NO3/c1-9(14)12(13(15)16)10(2)17-8-11-6-4-3-5-7-11/h3-7,9-10,12H,8,14H2,1-2H3,(H,15,16)/t9-,10+,12+/m1/s1
InChIKeyCXIQEFJARCFTGJ-SCVCMEIPSA-N
MW237.30 g/mol
LogP1.64
Rot. Bonds6

About (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid

(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid (PubChem CID 10728575) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid.

Molecular Properties

Compound Name(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid
PubChem CID10728575
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Name(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid
SMILESC[C@H](OCc1ccccc1)[C@@H](C(=O)O)[C@@H](C)N
InChIInChI=1S/C13H19NO3/c1-9(14)12(13(15)16)10(2)17-8-11-6-4-3-5-7-11/h3-7,9-10,12H,8,14H2,1-2H3,(H,15,16)/t9-,10+,12+/m1/s1
InChIKeyCXIQEFJARCFTGJ-SCVCMEIPSA-N
XLogP1.64
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid?
The IUPAC name of (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid (CID 10728575) is (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid.
What is the SMILES notation for (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid?
The canonical SMILES for (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid is C[C@H](OCc1ccccc1)[C@@H](C(=O)O)[C@@H](C)N.
What is the InChIKey of (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid?
The InChIKey is CXIQEFJARCFTGJ-SCVCMEIPSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9(14)12(13(15)16)10(2)17-8-11-6-4-3-5-7-11/h3-7,9-10,12H,8,14H2,1-2H3,(H,15,16)/t9-,10+,12+/m1/s1.
What are the key properties of (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid?
(2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid has a molecular weight of 237.30 g/mol, XLogP of 1.64, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-[(1R)-1-aminoethyl]-3-phenylmethoxybutanoic acid is sourced from PubChem (CID 10728575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).