C14H16BrNO2 — CID 107286268
1-[5-[(5-bromo-2-methylphenoxy)methyl]furan-3-yl]-N-methylmethanamine (PubChem CID 107286268) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 1-[5-[(5-bromo-2-methylphenoxy)methyl]furan-3-yl]-N-methylmethanamine.
| Compound Name | 1-[5-[(5-bromo-2-methylphenoxy)methyl]furan-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107286268 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-[5-[(5-bromo-2-methylphenoxy)methyl]furan-3-yl]-N-methylmethanamine |
| SMILES | CNCc1coc(COc2cc(Br)ccc2C)c1 |
| InChI | InChI=1S/C14H16BrNO2/c1-10-3-4-12(15)6-14(10)18-9-13-5-11(7-16-2)8-17-13/h3-6,8,16H,7,9H2,1-2H3 |
| InChIKey | HHKWKAHHBPWQEE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |