C14H12F4OS — CID 107287311
(5-ethylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol (PubChem CID 107287311) has the molecular formula C14H12F4OS and a molecular weight of 304.31 g/mol. Its IUPAC name is (5-ethylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (5-ethylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 107287311 |
| Molecular Formula | C14H12F4OS |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (5-ethylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol |
| SMILES | CCc1ccc(C(O)c2ccc(C(F)(F)F)c(F)c2)s1 |
| InChI | InChI=1S/C14H12F4OS/c1-2-9-4-6-12(20-9)13(19)8-3-5-10(11(15)7-8)14(16,17)18/h3-7,13,19H,2H2,1H3 |
| InChIKey | CYYIPCVVPVELAL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |