C13H9BrF4OS — CID 107287912
(4-bromo-5-methylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol (PubChem CID 107287912) has the molecular formula C13H9BrF4OS and a molecular weight of 369.18 g/mol. Its IUPAC name is (4-bromo-5-methylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-bromo-5-methylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 107287912 |
| Molecular Formula | C13H9BrF4OS |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | (4-bromo-5-methylthiophen-2-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1sc(C(O)c2ccc(C(F)(F)F)c(F)c2)cc1Br |
| InChI | InChI=1S/C13H9BrF4OS/c1-6-9(14)5-11(20-6)12(19)7-2-3-8(10(15)4-7)13(16,17)18/h2-5,12,19H,1H3 |
| InChIKey | BLGNHBPZXFBVSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |