C16H20BrN3O — CID 107287649
6-(5-bromo-2-methylphenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine (PubChem CID 107287649) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 6-(5-bromo-2-methylphenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-(5-bromo-2-methylphenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107287649 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 6-(5-bromo-2-methylphenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1ccc(Br)cc1Oc1nc(C(C)(C)C)nc(N)c1C |
| InChI | InChI=1S/C16H20BrN3O/c1-9-6-7-11(17)8-12(9)21-14-10(2)13(18)19-15(20-14)16(3,4)5/h6-8H,1-5H3,(H2,18,19,20) |
| InChIKey | KZAFFEVIDHMLLH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |