C15H16F4O2 — CID 107288374
[4-fluoro-3-(trifluoromethyl)phenyl]-(1-hydroxycycloheptyl)methanone (PubChem CID 107288374) has the molecular formula C15H16F4O2 and a molecular weight of 304.28 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-(1-hydroxycycloheptyl)methanone.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(1-hydroxycycloheptyl)methanone |
|---|---|
| PubChem CID | 107288374 |
| Molecular Formula | C15H16F4O2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(1-hydroxycycloheptyl)methanone |
| SMILES | O=C(c1ccc(F)c(C(F)(F)F)c1)C1(O)CCCCCC1 |
| InChI | InChI=1S/C15H16F4O2/c16-12-6-5-10(9-11(12)15(17,18)19)13(20)14(21)7-3-1-2-4-8-14/h5-6,9,21H,1-4,7-8H2 |
| InChIKey | NUXXJZIPEKJZSL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |