C15H17F4NO — CID 107288197
[1-(dimethylamino)cyclopentyl]-[3-fluoro-4-(trifluoromethyl)phenyl]methanone (PubChem CID 107288197) has the molecular formula C15H17F4NO and a molecular weight of 303.30 g/mol. Its IUPAC name is [1-(dimethylamino)cyclopentyl]-[3-fluoro-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [1-(dimethylamino)cyclopentyl]-[3-fluoro-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 107288197 |
| Molecular Formula | C15H17F4NO |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [1-(dimethylamino)cyclopentyl]-[3-fluoro-4-(trifluoromethyl)phenyl]methanone |
| SMILES | CN(C)C1(C(=O)c2ccc(C(F)(F)F)c(F)c2)CCCC1 |
| InChI | InChI=1S/C15H17F4NO/c1-20(2)14(7-3-4-8-14)13(21)10-5-6-11(12(16)9-10)15(17,18)19/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | ULHSSSCEPIYWJD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |