C13H12F4O2 — CID 107288226
[3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyloxolan-2-yl)methanone (PubChem CID 107288226) has the molecular formula C13H12F4O2 and a molecular weight of 276.23 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyloxolan-2-yl)methanone.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyloxolan-2-yl)methanone |
|---|---|
| PubChem CID | 107288226 |
| Molecular Formula | C13H12F4O2 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyloxolan-2-yl)methanone |
| SMILES | CC1(C(=O)c2ccc(C(F)(F)F)c(F)c2)CCCO1 |
| InChI | InChI=1S/C13H12F4O2/c1-12(5-2-6-19-12)11(18)8-3-4-9(10(14)7-8)13(15,16)17/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | TWDGNZSKVPVVOP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |