C14H12F4N2 — CID 107288835
[3-fluoro-4-(trifluoromethyl)phenyl]-(3-methyl-2-pyridinyl)methanamine (PubChem CID 107288835) has the molecular formula C14H12F4N2 and a molecular weight of 284.26 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl]-(3-methyl-2-pyridinyl)methanamine.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(3-methyl-2-pyridinyl)methanamine |
|---|---|
| PubChem CID | 107288835 |
| Molecular Formula | C14H12F4N2 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl]-(3-methyl-2-pyridinyl)methanamine |
| SMILES | Cc1cccnc1C(N)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H12F4N2/c1-8-3-2-6-20-13(8)12(19)9-4-5-10(11(15)7-9)14(16,17)18/h2-7,12H,19H2,1H3 |
| InChIKey | XTXYFPRGVATOTD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |