C14H11F4N3 — CID 107290535
2-cyclopropyl-6-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 107290535) has the molecular formula C14H11F4N3 and a molecular weight of 297.26 g/mol. Its IUPAC name is 2-cyclopropyl-6-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107290535 |
| Molecular Formula | C14H11F4N3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-cyclopropyl-6-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccc(F)c(C(F)(F)F)c2)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H11F4N3/c15-10-4-3-8(5-9(10)14(16,17)18)11-6-12(19)21-13(20-11)7-1-2-7/h3-7H,1-2H2,(H2,19,20,21) |
| InChIKey | AMMIKIJOGKGTMR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |