C15H15N3O — CID 104544998
2-cyclopropyl-6-(2,3-dihydro-1-benzofuran-5-yl)pyrimidin-4-amine (PubChem CID 104544998) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2,3-dihydro-1-benzofuran-5-yl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-(2,3-dihydro-1-benzofuran-5-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104544998 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-cyclopropyl-6-(2,3-dihydro-1-benzofuran-5-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)CCO3)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H15N3O/c16-14-8-12(17-15(18-14)9-1-2-9)10-3-4-13-11(7-10)5-6-19-13/h3-4,7-9H,1-2,5-6H2,(H2,16,17,18) |
| InChIKey | LDEZBDFMJOGZMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |