C11H10N2O2 — CID 66199605
5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine (PubChem CID 66199605) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199605 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)CCO3)on1 |
| InChI | InChI=1S/C11H10N2O2/c12-11-6-10(15-13-11)7-1-2-9-8(5-7)3-4-14-9/h1-2,5-6H,3-4H2,(H2,12,13) |
| InChIKey | HLJWYTUUSRYDCU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |