C13H14F5N — CID 107290834
3-[fluoro-[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 107290834) has the molecular formula C13H14F5N and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-[fluoro-[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 3-[fluoro-[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 107290834 |
| Molecular Formula | C13H14F5N |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[fluoro-[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | Fc1ccc(C(F)C2CCCNC2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F5N/c14-11-4-3-8(6-10(11)13(16,17)18)12(15)9-2-1-5-19-7-9/h3-4,6,9,12,19H,1-2,5,7H2 |
| InChIKey | YQXPOHREMIGMKW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |