C11H11F4NO2 — CID 107291086
2-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methoxypropan-1-one (PubChem CID 107291086) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methoxypropan-1-one.
| Compound Name | 2-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 107291086 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methoxypropan-1-one |
| SMILES | COCC(N)C(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F4NO2/c1-18-5-9(16)10(17)6-2-3-8(12)7(4-6)11(13,14)15/h2-4,9H,5,16H2,1H3 |
| InChIKey | MMSYWZWAEWNFJI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |