C12H13F4NO — CID 107291094
4-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-one (PubChem CID 107291094) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-one.
| Compound Name | 4-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 107291094 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylbutan-1-one |
| SMILES | CC(CN)CC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4NO/c1-7(6-17)4-11(18)8-2-3-10(13)9(5-8)12(14,15)16/h2-3,5,7H,4,6,17H2,1H3 |
| InChIKey | YDRMEXQIHWSOIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |