C14H17F4NO — CID 107291454
1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-(oxolan-2-yl)propan-1-amine (PubChem CID 107291454) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 107291454 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-(oxolan-2-yl)propan-1-amine |
| SMILES | NC(CCC1CCCO1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H17F4NO/c15-12-8-9(3-5-11(12)14(16,17)18)13(19)6-4-10-2-1-7-20-10/h3,5,8,10,13H,1-2,4,6-7,19H2 |
| InChIKey | KBSLYSDZWKUYOO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |