C13H12F4N2S — CID 107292364
[[4-fluoro-3-(trifluoromethyl)phenyl]-(4-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 107292364) has the molecular formula C13H12F4N2S and a molecular weight of 304.31 g/mol. Its IUPAC name is [[4-fluoro-3-(trifluoromethyl)phenyl]-(4-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(4-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107292364 |
| Molecular Formula | C13H12F4N2S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(4-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1cscc1C(NN)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F4N2S/c1-7-5-20-6-9(7)12(19-18)8-2-3-11(14)10(4-8)13(15,16)17/h2-6,12,19H,18H2,1H3 |
| InChIKey | RJWVOMOWBVZNIT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|