C17H17NO2S — CID 107292847
2-benzhydryl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 107292847) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-benzhydryl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-benzhydryl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107292847 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-benzhydryl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(C(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C17H17NO2S/c19-17(20)14-11-21-16(18-14)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-16,18H,11H2,(H,19,20) |
| InChIKey | XDZCEILFQOVVLF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |