C11H11NO4S — CID 739068
(2R,4S)-2-(2-carboxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 739068) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is (2R,4S)-2-(2-carboxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-2-(2-carboxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 739068 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (2R,4S)-2-(2-carboxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccccc1[C@@H]1N[C@@H](C(=O)O)CS1 |
| InChI | InChI=1S/C11H11NO4S/c13-10(14)7-4-2-1-3-6(7)9-12-8(5-17-9)11(15)16/h1-4,8-9,12H,5H2,(H,13,14)(H,15,16)/t8-,9-/m1/s1 |
| InChIKey | BBGKHXCXWMNFPK-RKDXNWHRSA-N |
| XLogP | 1.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |