C14H27NOSi — CID 10729578
(E)-2-methyl-2-triethylsilyloxyhept-5-enenitrile (PubChem CID 10729578) has the molecular formula C14H27NOSi and a molecular weight of 253.46 g/mol. Its IUPAC name is (E)-2-methyl-2-triethylsilyloxyhept-5-enenitrile.
| Compound Name | (E)-2-methyl-2-triethylsilyloxyhept-5-enenitrile |
|---|---|
| PubChem CID | 10729578 |
| Molecular Formula | C14H27NOSi |
| Molecular Weight | 253.46 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | (E)-2-methyl-2-triethylsilyloxyhept-5-enenitrile |
| SMILES | C/C=C/CCC(C)(C#N)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H27NOSi/c1-6-10-11-12-14(5,13-15)16-17(7-2,8-3)9-4/h6,10H,7-9,11-12H2,1-5H3/b10-6+ |
| InChIKey | WFGUSNSXIBFURP-UXBLZVDNSA-N |
| XLogP | 4.65 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|