C11H21NOSi — CID 135055890
(Z,2S)-2-propyl-2-trimethylsilyloxypent-3-enenitrile (PubChem CID 135055890) has the molecular formula C11H21NOSi and a molecular weight of 211.38 g/mol. Its IUPAC name is (Z,2S)-2-propyl-2-trimethylsilyloxypent-3-enenitrile.
| Compound Name | (Z,2S)-2-propyl-2-trimethylsilyloxypent-3-enenitrile |
|---|---|
| PubChem CID | 135055890 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (Z,2S)-2-propyl-2-trimethylsilyloxypent-3-enenitrile |
| SMILES | C/C=C\[C@](C#N)(CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H21NOSi/c1-6-8-11(10-12,9-7-2)13-14(3,4)5/h6,8H,7,9H2,1-5H3/b8-6-/t11-/m1/s1 |
| InChIKey | KCTCNZKJQAGIME-BPOWMSRESA-N |
| XLogP | 3.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|