C11H21NOSi — CID 129409570
(E,2S)-2-methyl-2-trimethylsilyloxyhept-3-enenitrile (PubChem CID 129409570) has the molecular formula C11H21NOSi and a molecular weight of 211.38 g/mol. Its IUPAC name is (E,2S)-2-methyl-2-trimethylsilyloxyhept-3-enenitrile.
| Compound Name | (E,2S)-2-methyl-2-trimethylsilyloxyhept-3-enenitrile |
|---|---|
| PubChem CID | 129409570 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (E,2S)-2-methyl-2-trimethylsilyloxyhept-3-enenitrile |
| SMILES | CCC/C=C/[C@@](C)(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C11H21NOSi/c1-6-7-8-9-11(2,10-12)13-14(3,4)5/h8-9H,6-7H2,1-5H3/b9-8+/t11-/m0/s1 |
| InChIKey | LQDXSQVSHUFAKQ-FBOQAHMBSA-N |
| XLogP | 3.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|