C13H25NOSi — CID 135056615
(Z,2R)-2-methyl-2-trimethylsilyloxynon-3-enenitrile (PubChem CID 135056615) has the molecular formula C13H25NOSi and a molecular weight of 239.43 g/mol. Its IUPAC name is (Z,2R)-2-methyl-2-trimethylsilyloxynon-3-enenitrile.
| Compound Name | (Z,2R)-2-methyl-2-trimethylsilyloxynon-3-enenitrile |
|---|---|
| PubChem CID | 135056615 |
| Molecular Formula | C13H25NOSi |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (Z,2R)-2-methyl-2-trimethylsilyloxynon-3-enenitrile |
| SMILES | CCCCC/C=C\[C@](C)(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C13H25NOSi/c1-6-7-8-9-10-11-13(2,12-14)15-16(3,4)5/h10-11H,6-9H2,1-5H3/b11-10-/t13-/m1/s1 |
| InChIKey | SJFOTVNAYOZRNH-BSYHEUMXSA-N |
| XLogP | 4.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|