C13H23NOSi — CID 11402150
(3E)-4,7-dimethyl-2-trimethylsilyloxyocta-3,7-dienenitrile (PubChem CID 11402150) has the molecular formula C13H23NOSi and a molecular weight of 237.42 g/mol. Its IUPAC name is (3E)-4,7-dimethyl-2-trimethylsilyloxyocta-3,7-dienenitrile.
| Compound Name | (3E)-4,7-dimethyl-2-trimethylsilyloxyocta-3,7-dienenitrile |
|---|---|
| PubChem CID | 11402150 |
| Molecular Formula | C13H23NOSi |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (3E)-4,7-dimethyl-2-trimethylsilyloxyocta-3,7-dienenitrile |
| SMILES | C=C(C)CC/C(C)=C/C(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C13H23NOSi/c1-11(2)7-8-12(3)9-13(10-14)15-16(4,5)6/h9,13H,1,7-8H2,2-6H3/b12-9+ |
| InChIKey | IJYKDWCUGBTXHL-FMIVXFBMSA-N |
| XLogP | 4.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|