C8H15NOSi — CID 11147967
(E,2S)-2-trimethylsilyloxypent-3-enenitrile (PubChem CID 11147967) has the molecular formula C8H15NOSi and a molecular weight of 169.30 g/mol. Its IUPAC name is (E,2S)-2-trimethylsilyloxypent-3-enenitrile.
| Compound Name | (E,2S)-2-trimethylsilyloxypent-3-enenitrile |
|---|---|
| PubChem CID | 11147967 |
| Molecular Formula | C8H15NOSi |
| Molecular Weight | 169.30 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (E,2S)-2-trimethylsilyloxypent-3-enenitrile |
| SMILES | C/C=C/[C@@H](C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C8H15NOSi/c1-5-6-8(7-9)10-11(2,3)4/h5-6,8H,1-4H3/b6-5+/t8-/m0/s1 |
| InChIKey | WWNMTKNCFACRKM-GJIOHYHPSA-N |
| XLogP | 2.31 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|