C10H19NOSi — CID 11680004
(E,2R)-2-trimethylsilyloxyhept-3-enenitrile (PubChem CID 11680004) has the molecular formula C10H19NOSi and a molecular weight of 197.35 g/mol. Its IUPAC name is (E,2R)-2-trimethylsilyloxyhept-3-enenitrile.
| Compound Name | (E,2R)-2-trimethylsilyloxyhept-3-enenitrile |
|---|---|
| PubChem CID | 11680004 |
| Molecular Formula | C10H19NOSi |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (E,2R)-2-trimethylsilyloxyhept-3-enenitrile |
| SMILES | CCC/C=C/[C@H](C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C10H19NOSi/c1-5-6-7-8-10(9-11)12-13(2,3)4/h7-8,10H,5-6H2,1-4H3/b8-7+/t10-/m1/s1 |
| InChIKey | MIZYANNLJTVJNC-QROSGCPLSA-N |
| XLogP | 3.09 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|