C14H25NOSi — CID 11265227
(3Z)-4,8-dimethyl-2-trimethylsilyloxynona-3,7-dienenitrile (PubChem CID 11265227) has the molecular formula C14H25NOSi and a molecular weight of 251.45 g/mol. Its IUPAC name is (3Z)-4,8-dimethyl-2-trimethylsilyloxynona-3,7-dienenitrile.
| Compound Name | (3Z)-4,8-dimethyl-2-trimethylsilyloxynona-3,7-dienenitrile |
|---|---|
| PubChem CID | 11265227 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3Z)-4,8-dimethyl-2-trimethylsilyloxynona-3,7-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C\C(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C14H25NOSi/c1-12(2)8-7-9-13(3)10-14(11-15)16-17(4,5)6/h8,10,14H,7,9H2,1-6H3/b13-10- |
| InChIKey | CWTGYUZZEGZIBX-RAXLEYEMSA-N |
| XLogP | 4.42 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|