C9H15N3O2S2 — CID 107296276
N'-(2-amino-2-sulfanylideneethyl)-N-(thiolan-3-ylmethyl)oxamide (PubChem CID 107296276) has the molecular formula C9H15N3O2S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N'-(2-amino-2-sulfanylideneethyl)-N-(thiolan-3-ylmethyl)oxamide.
| Compound Name | N'-(2-amino-2-sulfanylideneethyl)-N-(thiolan-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 107296276 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N'-(2-amino-2-sulfanylideneethyl)-N-(thiolan-3-ylmethyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)NCC1CCSC1 |
| InChI | InChI=1S/C9H15N3O2S2/c10-7(15)4-12-9(14)8(13)11-3-6-1-2-16-5-6/h6H,1-5H2,(H2,10,15)(H,11,13)(H,12,14) |
| InChIKey | UDHHQCUPJQALCY-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|