C14H17N3O2S2 — CID 107298100
2-amino-N-(thiolan-3-ylmethyl)quinoline-6-sulfonamide (PubChem CID 107298100) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-amino-N-(thiolan-3-ylmethyl)quinoline-6-sulfonamide.
| Compound Name | 2-amino-N-(thiolan-3-ylmethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 107298100 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-amino-N-(thiolan-3-ylmethyl)quinoline-6-sulfonamide |
| SMILES | Nc1ccc2cc(S(=O)(=O)NCC3CCSC3)ccc2n1 |
| InChI | InChI=1S/C14H17N3O2S2/c15-14-4-1-11-7-12(2-3-13(11)17-14)21(18,19)16-8-10-5-6-20-9-10/h1-4,7,10,16H,5-6,8-9H2,(H2,15,17) |
| InChIKey | CSKLXTCIDRQAOW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |