C14H13N3O2S2 — CID 62143229
2-amino-N-(thiophen-2-ylmethyl)quinoline-6-sulfonamide (PubChem CID 62143229) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-amino-N-(thiophen-2-ylmethyl)quinoline-6-sulfonamide.
| Compound Name | 2-amino-N-(thiophen-2-ylmethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 62143229 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-amino-N-(thiophen-2-ylmethyl)quinoline-6-sulfonamide |
| SMILES | Nc1ccc2cc(S(=O)(=O)NCc3cccs3)ccc2n1 |
| InChI | InChI=1S/C14H13N3O2S2/c15-14-6-3-10-8-12(4-5-13(10)17-14)21(18,19)16-9-11-2-1-7-20-11/h1-8,16H,9H2,(H2,15,17) |
| InChIKey | NNBHWPNAQLGPFH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |