C16H32N2S — CID 107298471
5,5-diethyl-2-propan-2-yl-1-(thiolan-3-ylmethyl)piperazine (PubChem CID 107298471) has the molecular formula C16H32N2S and a molecular weight of 284.51 g/mol. Its IUPAC name is 5,5-diethyl-2-propan-2-yl-1-(thiolan-3-ylmethyl)piperazine.
| Compound Name | 5,5-diethyl-2-propan-2-yl-1-(thiolan-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 107298471 |
| Molecular Formula | C16H32N2S |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 5,5-diethyl-2-propan-2-yl-1-(thiolan-3-ylmethyl)piperazine |
| SMILES | CCC1(CC)CN(CC2CCSC2)C(C(C)C)CN1 |
| InChI | InChI=1S/C16H32N2S/c1-5-16(6-2)12-18(10-14-7-8-19-11-14)15(9-17-16)13(3)4/h13-15,17H,5-12H2,1-4H3 |
| InChIKey | TZNVKQGIQHIOHB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |